C21H26ClF2N5O2 — CID 129294170
4-chloro-3-fluoro-N-[[[5-(4-fluorophenyl)pyrazolidin-3-yl]amino]-[[(2S)-1-methoxypropan-2-yl]amino]methyl]benzamide (PubChem CID 129294170) has the molecular formula C21H26ClF2N5O2 and a molecular weight of 453.92 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-[[[5-(4-fluorophenyl)pyrazolidin-3-yl]amino]-[[(2S)-1-methoxypropan-2-yl]amino]methyl]benzamide.
| Compound Name | 4-chloro-3-fluoro-N-[[[5-(4-fluorophenyl)pyrazolidin-3-yl]amino]-[[(2S)-1-methoxypropan-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 129294170 |
| Molecular Formula | C21H26ClF2N5O2 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-chloro-3-fluoro-N-[[[5-(4-fluorophenyl)pyrazolidin-3-yl]amino]-[[(2S)-1-methoxypropan-2-yl]amino]methyl]benzamide |
| SMILES | COC[C@H](C)NC(NC(=O)c1ccc(Cl)c(F)c1)NC1CC(c2ccc(F)cc2)NN1 |
| InChI | InChI=1S/C21H26ClF2N5O2/c1-12(11-31-2)25-21(27-20(30)14-5-8-16(22)17(24)9-14)26-19-10-18(28-29-19)13-3-6-15(23)7-4-13/h3-9,12,18-19,21,25-26,28-29H,10-11H2,1-2H3,(H,27,30)/t12-,18?,19?,21?/m0/s1 |
| InChIKey | VJZVQLPQGWRVFO-BMALZVAQSA-N |
| XLogP | 2.41 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|