C21H24F3N5O2 — CID 118375538
N-[N'-(2-ethoxyethyl)-N-[5-(4-fluorophenyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 118375538) has the molecular formula C21H24F3N5O2 and a molecular weight of 435.45 g/mol. Its IUPAC name is N-[N'-(2-ethoxyethyl)-N-[5-(4-fluorophenyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N'-(2-ethoxyethyl)-N-[5-(4-fluorophenyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 118375538 |
| Molecular Formula | C21H24F3N5O2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-[N'-(2-ethoxyethyl)-N-[5-(4-fluorophenyl)pyrazolidin-3-yl]carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CCOCC/N=C(\NC(=O)c1ccc(F)c(F)c1)NC1CC(c2ccc(F)cc2)NN1 |
| InChI | InChI=1S/C21H24F3N5O2/c1-2-31-10-9-25-21(27-20(30)14-5-8-16(23)17(24)11-14)26-19-12-18(28-29-19)13-3-6-15(22)7-4-13/h3-8,11,18-19,28-29H,2,9-10,12H2,1H3,(H2,25,26,27,30) |
| InChIKey | ZMZKHTDKFFWOLY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|