C19H25F4N5O — CID 130434788
4-fluoro-N-[N'-[(3-methylcyclopentyl)methyl]-N-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]benzamide (PubChem CID 130434788) has the molecular formula C19H25F4N5O and a molecular weight of 415.44 g/mol. Its IUPAC name is 4-fluoro-N-[N'-[(3-methylcyclopentyl)methyl]-N-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]benzamide.
| Compound Name | 4-fluoro-N-[N'-[(3-methylcyclopentyl)methyl]-N-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 130434788 |
| Molecular Formula | C19H25F4N5O |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-fluoro-N-[N'-[(3-methylcyclopentyl)methyl]-N-[5-(trifluoromethyl)pyrazolidin-3-yl]carbamimidoyl]benzamide |
| SMILES | CC1CCC(C/N=C(\NC(=O)c2ccc(F)cc2)NC2CC(C(F)(F)F)NN2)C1 |
| InChI | InChI=1S/C19H25F4N5O/c1-11-2-3-12(8-11)10-24-18(25-16-9-15(27-28-16)19(21,22)23)26-17(29)13-4-6-14(20)7-5-13/h4-7,11-12,15-16,27-28H,2-3,8-10H2,1H3,(H2,24,25,26,29) |
| InChIKey | JDDGVMCJZXRYRM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|