C16H22FNO — CID 171733091
N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-4-fluorobenzamide (PubChem CID 171733091) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-4-fluorobenzamide.
| Compound Name | N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 171733091 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-4-fluorobenzamide |
| SMILES | CC(C)(C)C(CC1CC1)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FNO/c1-16(2,3)14(10-11-4-5-11)18-15(19)12-6-8-13(17)9-7-12/h6-9,11,14H,4-5,10H2,1-3H3,(H,18,19) |
| InChIKey | UCHOSUNSMHJQNF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |