C13H24FNO — CID 171733283
N-(1-cyclohexyl-3,3-dimethylbutan-2-yl)carbamoyl fluoride (PubChem CID 171733283) has the molecular formula C13H24FNO and a molecular weight of 229.34 g/mol. Its IUPAC name is N-(1-cyclohexyl-3,3-dimethylbutan-2-yl)carbamoyl fluoride.
| Compound Name | N-(1-cyclohexyl-3,3-dimethylbutan-2-yl)carbamoyl fluoride |
|---|---|
| PubChem CID | 171733283 |
| Molecular Formula | C13H24FNO |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-(1-cyclohexyl-3,3-dimethylbutan-2-yl)carbamoyl fluoride |
| SMILES | CC(C)(C)C(CC1CCCCC1)NC(=O)F |
| InChI | InChI=1S/C13H24FNO/c1-13(2,3)11(15-12(14)16)9-10-7-5-4-6-8-10/h10-11H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | CVJVOXSGIAGUMI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|