C19H18ClF2N5O2 — CID 123835166
N-[N-(6-chloro-1H-indazol-3-yl)-N'-(2-ethoxyethyl)carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 123835166) has the molecular formula C19H18ClF2N5O2 and a molecular weight of 421.84 g/mol. Its IUPAC name is N-[N-(6-chloro-1H-indazol-3-yl)-N'-(2-ethoxyethyl)carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-(6-chloro-1H-indazol-3-yl)-N'-(2-ethoxyethyl)carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 123835166 |
| Molecular Formula | C19H18ClF2N5O2 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[N-(6-chloro-1H-indazol-3-yl)-N'-(2-ethoxyethyl)carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CCOCC/N=C(\NC(=O)c1ccc(F)c(F)c1)Nc1n[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H18ClF2N5O2/c1-2-29-8-7-23-19(25-18(28)11-3-6-14(21)15(22)9-11)24-17-13-5-4-12(20)10-16(13)26-27-17/h3-6,9-10H,2,7-8H2,1H3,(H3,23,24,25,26,27,28) |
| InChIKey | PYGQIUMWSMNUQN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|