C20H17Cl3FN5O — CID 72944627
3,4-dichloro-N-[N-(6-chloro-5-fluoro-1H-indazol-3-yl)-N'-cyclopentylcarbamimidoyl]benzamide (PubChem CID 72944627) has the molecular formula C20H17Cl3FN5O and a molecular weight of 468.75 g/mol. Its IUPAC name is 3,4-dichloro-N-[N-(6-chloro-5-fluoro-1H-indazol-3-yl)-N'-cyclopentylcarbamimidoyl]benzamide.
| Compound Name | 3,4-dichloro-N-[N-(6-chloro-5-fluoro-1H-indazol-3-yl)-N'-cyclopentylcarbamimidoyl]benzamide |
|---|---|
| PubChem CID | 72944627 |
| Molecular Formula | C20H17Cl3FN5O |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3,4-dichloro-N-[N-(6-chloro-5-fluoro-1H-indazol-3-yl)-N'-cyclopentylcarbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\C1CCCC1)Nc1n[nH]c2cc(Cl)c(F)cc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl3FN5O/c21-13-6-5-10(7-14(13)22)19(30)27-20(25-11-3-1-2-4-11)26-18-12-8-16(24)15(23)9-17(12)28-29-18/h5-9,11H,1-4H2,(H3,25,26,27,28,29,30) |
| InChIKey | WCLTVBGRUXCMKO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|