C20H19ClF3N3O — CID 67967099
N-[N-(3-chloro-5-fluorophenyl)-N'-cyclohexylcarbamimidoyl]-3,4-difluorobenzamide (PubChem CID 67967099) has the molecular formula C20H19ClF3N3O and a molecular weight of 409.84 g/mol. Its IUPAC name is N-[N-(3-chloro-5-fluorophenyl)-N'-cyclohexylcarbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-(3-chloro-5-fluorophenyl)-N'-cyclohexylcarbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 67967099 |
| Molecular Formula | C20H19ClF3N3O |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[N-(3-chloro-5-fluorophenyl)-N'-cyclohexylcarbamimidoyl]-3,4-difluorobenzamide |
| SMILES | O=C(N/C(=N\C1CCCCC1)Nc1cc(F)cc(Cl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H19ClF3N3O/c21-13-9-14(22)11-16(10-13)26-20(25-15-4-2-1-3-5-15)27-19(28)12-6-7-17(23)18(24)8-12/h6-11,15H,1-5H2,(H2,25,26,27,28) |
| InChIKey | IZYSACTZOWOZFA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|