C26H25ClF4N5O+ — CID 123259420
[(2-amino-6-fluorophenyl)-[[(3-chloro-5-fluoroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]methyl]-butylidene-methylazanium (PubChem CID 123259420) has the molecular formula C26H25ClF4N5O+ and a molecular weight of 534.97 g/mol. Its IUPAC name is [(2-amino-6-fluorophenyl)-[[(3-chloro-5-fluoroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]methyl]-butylidene-methylazanium.
| Compound Name | [(2-amino-6-fluorophenyl)-[[(3-chloro-5-fluoroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]methyl]-butylidene-methylazanium |
|---|---|
| PubChem CID | 123259420 |
| Molecular Formula | C26H25ClF4N5O+ |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | [(2-amino-6-fluorophenyl)-[[(3-chloro-5-fluoroanilino)-[(3,4-difluorobenzoyl)amino]methylidene]amino]methyl]-butylidene-methylazanium |
| SMILES | CCCC=[N+](C)C(N=C(NC(=O)c1ccc(F)c(F)c1)Nc1cc(F)cc(Cl)c1)c1c(N)cccc1F |
| InChI | InChI=1S/C26H24ClF4N5O/c1-3-4-10-36(2)24(23-20(30)6-5-7-22(23)32)34-26(33-18-13-16(27)12-17(28)14-18)35-25(37)15-8-9-19(29)21(31)11-15/h5-14,24H,3-4,32H2,1-2H3,(H-,33,34,35,37)/p+1 |
| InChIKey | AHLXCQMEYQGDEX-UHFFFAOYSA-O |
| XLogP | 5.89 |
| TPSA | 82.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|