C26H17Cl2FN6O3S — CID 137153907
4-chloro-N-[N-(3-chloro-5-fluorophenyl)-N'-[6-[(2-cyanophenyl)sulfonylamino]-2-pyridinyl]carbamimidoyl]benzamide (PubChem CID 137153907) has the molecular formula C26H17Cl2FN6O3S and a molecular weight of 583.43 g/mol. Its IUPAC name is 4-chloro-N-[N-(3-chloro-5-fluorophenyl)-N'-[6-[(2-cyanophenyl)sulfonylamino]-2-pyridinyl]carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-(3-chloro-5-fluorophenyl)-N'-[6-[(2-cyanophenyl)sulfonylamino]-2-pyridinyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 137153907 |
| Molecular Formula | C26H17Cl2FN6O3S |
| Molecular Weight | 583.43 g/mol |
| Exact Mass | 582.04 |
| IUPAC Name | 4-chloro-N-[N-(3-chloro-5-fluorophenyl)-N'-[6-[(2-cyanophenyl)sulfonylamino]-2-pyridinyl]carbamimidoyl]benzamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)Nc1cccc(N=C(NC(=O)c2ccc(Cl)cc2)Nc2cc(F)cc(Cl)c2)n1 |
| InChI | InChI=1S/C26H17Cl2FN6O3S/c27-18-10-8-16(9-11-18)25(36)34-26(31-21-13-19(28)12-20(29)14-21)33-23-6-3-7-24(32-23)35-39(37,38)22-5-2-1-4-17(22)15-30/h1-14H,(H3,31,32,33,34,35,36) |
| InChIKey | IAEMLMMQKDWCCO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|