C27H19Cl2FN6O3S — CID 136960338
4-chloro-N-[N-(3-chloro-5-fluorophenyl)-C-[[[6-[(2-cyanophenyl)sulfonylamino]-2-pyridinyl]amino]methyl]carbonimidoyl]benzamide (PubChem CID 136960338) has the molecular formula C27H19Cl2FN6O3S and a molecular weight of 597.46 g/mol. Its IUPAC name is 4-chloro-N-[N-(3-chloro-5-fluorophenyl)-C-[[[6-[(2-cyanophenyl)sulfonylamino]-2-pyridinyl]amino]methyl]carbonimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-(3-chloro-5-fluorophenyl)-C-[[[6-[(2-cyanophenyl)sulfonylamino]-2-pyridinyl]amino]methyl]carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 136960338 |
| Molecular Formula | C27H19Cl2FN6O3S |
| Molecular Weight | 597.46 g/mol |
| Exact Mass | 596.06 |
| IUPAC Name | 4-chloro-N-[N-(3-chloro-5-fluorophenyl)-C-[[[6-[(2-cyanophenyl)sulfonylamino]-2-pyridinyl]amino]methyl]carbonimidoyl]benzamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)Nc1cccc(NC/C(=N/c2cc(F)cc(Cl)c2)NC(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C27H19Cl2FN6O3S/c28-19-10-8-17(9-11-19)27(37)35-26(33-22-13-20(29)12-21(30)14-22)16-32-24-6-3-7-25(34-24)36-40(38,39)23-5-2-1-4-18(23)15-31/h1-14H,16H2,(H2,32,34,36)(H,33,35,37) |
| InChIKey | INLOWLJDCUNJQN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|