C23H20FN3O3S — CID 18208923
4-[[(2-cyanophenyl)sulfonylamino]methyl]-N-[(4-fluoro-3-methylphenyl)methyl]benzamide (PubChem CID 18208923) has the molecular formula C23H20FN3O3S and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-[[(2-cyanophenyl)sulfonylamino]methyl]-N-[(4-fluoro-3-methylphenyl)methyl]benzamide.
| Compound Name | 4-[[(2-cyanophenyl)sulfonylamino]methyl]-N-[(4-fluoro-3-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18208923 |
| Molecular Formula | C23H20FN3O3S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 4-[[(2-cyanophenyl)sulfonylamino]methyl]-N-[(4-fluoro-3-methylphenyl)methyl]benzamide |
| SMILES | Cc1cc(CNC(=O)c2ccc(CNS(=O)(=O)c3ccccc3C#N)cc2)ccc1F |
| InChI | InChI=1S/C23H20FN3O3S/c1-16-12-18(8-11-21(16)24)14-26-23(28)19-9-6-17(7-10-19)15-27-31(29,30)22-5-3-2-4-20(22)13-25/h2-12,27H,14-15H2,1H3,(H,26,28) |
| InChIKey | ZBZPOTJCUJDPNA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |