C16H15N3O3S — CID 8713182
N-benzyl-2-[(2-cyanophenyl)sulfonylamino]acetamide (PubChem CID 8713182) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-benzyl-2-[(2-cyanophenyl)sulfonylamino]acetamide.
| Compound Name | N-benzyl-2-[(2-cyanophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 8713182 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-benzyl-2-[(2-cyanophenyl)sulfonylamino]acetamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)NCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H15N3O3S/c17-10-14-8-4-5-9-15(14)23(21,22)19-12-16(20)18-11-13-6-2-1-3-7-13/h1-9,19H,11-12H2,(H,18,20) |
| InChIKey | ZZMXPEHCPYTDNL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |