C19H23N4O3S+ — CID 8937621
[(2R)-2-[[2-[(2-cyanophenyl)sulfonylamino]acetyl]amino]-2-phenylethyl]-dimethylazanium (PubChem CID 8937621) has the molecular formula C19H23N4O3S+ and a molecular weight of 387.49 g/mol. Its IUPAC name is [(2R)-2-[[2-[(2-cyanophenyl)sulfonylamino]acetyl]amino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2R)-2-[[2-[(2-cyanophenyl)sulfonylamino]acetyl]amino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8937621 |
| Molecular Formula | C19H23N4O3S+ |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [(2R)-2-[[2-[(2-cyanophenyl)sulfonylamino]acetyl]amino]-2-phenylethyl]-dimethylazanium |
| SMILES | C[NH+](C)C[C@H](NC(=O)CNS(=O)(=O)c1ccccc1C#N)c1ccccc1 |
| InChI | InChI=1S/C19H22N4O3S/c1-23(2)14-17(15-8-4-3-5-9-15)22-19(24)13-21-27(25,26)18-11-7-6-10-16(18)12-20/h3-11,17,21H,13-14H2,1-2H3,(H,22,24)/p+1/t17-/m0/s1 |
| InChIKey | IAFBRYDUQVVPKX-KRWDZBQOSA-O |
| XLogP | -0.16 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |