C20H13ClF4N4O2 — CID 137141235
N-[N-(3-chloro-5-fluorophenyl)-N'-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-3-(trifluoromethyl)benzamide (PubChem CID 137141235) has the molecular formula C20H13ClF4N4O2 and a molecular weight of 452.80 g/mol. Its IUPAC name is N-[N-(3-chloro-5-fluorophenyl)-N'-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[N-(3-chloro-5-fluorophenyl)-N'-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137141235 |
| Molecular Formula | C20H13ClF4N4O2 |
| Molecular Weight | 452.80 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-[N-(3-chloro-5-fluorophenyl)-N'-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NC(=Nc1cccc(=O)[nH]1)Nc1cc(F)cc(Cl)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13ClF4N4O2/c21-13-8-14(22)10-15(9-13)26-19(28-16-5-2-6-17(30)27-16)29-18(31)11-3-1-4-12(7-11)20(23,24)25/h1-10H,(H3,26,27,28,29,30,31) |
| InChIKey | GIODCCDGFHETNJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|