C21H15ClF3N3O2 — CID 158605809
4-chloro-N-[C-[(6-oxo-1H-pyridin-2-yl)methyl]-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]benzamide (PubChem CID 158605809) has the molecular formula C21H15ClF3N3O2 and a molecular weight of 433.82 g/mol. Its IUPAC name is 4-chloro-N-[C-[(6-oxo-1H-pyridin-2-yl)methyl]-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]benzamide.
| Compound Name | 4-chloro-N-[C-[(6-oxo-1H-pyridin-2-yl)methyl]-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 158605809 |
| Molecular Formula | C21H15ClF3N3O2 |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 4-chloro-N-[C-[(6-oxo-1H-pyridin-2-yl)methyl]-N-[3-(trifluoromethyl)phenyl]carbonimidoyl]benzamide |
| SMILES | O=C(N/C(Cc1cccc(=O)[nH]1)=N/c1cccc(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15ClF3N3O2/c22-15-9-7-13(8-10-15)20(30)28-18(12-17-5-2-6-19(29)27-17)26-16-4-1-3-14(11-16)21(23,24)25/h1-11H,12H2,(H,27,29)(H,26,28,30) |
| InChIKey | HWFAEVVQIIVXRL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|