C23H20ClF3N4O2 — CID 118528999
N-[N-[1-(2-chlorophenyl)ethyl]-C-[[(6-oxo-1H-pyridin-2-yl)amino]methyl]carbonimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 118528999) has the molecular formula C23H20ClF3N4O2 and a molecular weight of 476.89 g/mol. Its IUPAC name is N-[N-[1-(2-chlorophenyl)ethyl]-C-[[(6-oxo-1H-pyridin-2-yl)amino]methyl]carbonimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N-[1-(2-chlorophenyl)ethyl]-C-[[(6-oxo-1H-pyridin-2-yl)amino]methyl]carbonimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118528999 |
| Molecular Formula | C23H20ClF3N4O2 |
| Molecular Weight | 476.89 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-[N-[1-(2-chlorophenyl)ethyl]-C-[[(6-oxo-1H-pyridin-2-yl)amino]methyl]carbonimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(/N=C(\CNc1cccc(=O)[nH]1)NC(=O)c1ccc(C(F)(F)F)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C23H20ClF3N4O2/c1-14(17-5-2-3-6-18(17)24)29-20(13-28-19-7-4-8-21(32)30-19)31-22(33)15-9-11-16(12-10-15)23(25,26)27/h2-12,14H,13H2,1H3,(H2,28,30,32)(H,29,31,33) |
| InChIKey | CMTNLSQDEVRVHD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|