C22H22F6N4O2 — CID 118528997
N-[C-[[(6-oxo-1H-pyridin-2-yl)amino]methyl]-N-[4-(trifluoromethyl)cyclohexyl]carbonimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 118528997) has the molecular formula C22H22F6N4O2 and a molecular weight of 488.43 g/mol. Its IUPAC name is N-[C-[[(6-oxo-1H-pyridin-2-yl)amino]methyl]-N-[4-(trifluoromethyl)cyclohexyl]carbonimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[C-[[(6-oxo-1H-pyridin-2-yl)amino]methyl]-N-[4-(trifluoromethyl)cyclohexyl]carbonimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118528997 |
| Molecular Formula | C22H22F6N4O2 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-[C-[[(6-oxo-1H-pyridin-2-yl)amino]methyl]-N-[4-(trifluoromethyl)cyclohexyl]carbonimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N/C(CNc1cccc(=O)[nH]1)=N/C1CCC(C(F)(F)F)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F6N4O2/c23-21(24,25)14-6-4-13(5-7-14)20(34)32-18(12-29-17-2-1-3-19(33)31-17)30-16-10-8-15(9-11-16)22(26,27)28/h1-7,15-16H,8-12H2,(H2,29,31,33)(H,30,32,34) |
| InChIKey | GXNSKRUMJBWKCS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|