C24H26F3N3O2 — CID 57382724
N-[N-(2-cyclopropylphenyl)-N'-(4-hydroxycyclohexyl)carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 57382724) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[N-(2-cyclopropylphenyl)-N'-(4-hydroxycyclohexyl)carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N-(2-cyclopropylphenyl)-N'-(4-hydroxycyclohexyl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 57382724 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[N-(2-cyclopropylphenyl)-N'-(4-hydroxycyclohexyl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N/C(=N\C1CCC(O)CC1)Nc1ccccc1C1CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H26F3N3O2/c25-24(26,27)17-9-7-16(8-10-17)22(32)30-23(28-18-11-13-19(31)14-12-18)29-21-4-2-1-3-20(21)15-5-6-15/h1-4,7-10,15,18-19,31H,5-6,11-14H2,(H2,28,29,30,32) |
| InChIKey | DKVBUDOTZIMNHL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|