C22H21F6N3O2 — CID 57383239
N-[N'-(4-hydroxycyclohexyl)-N-[4-(trifluoromethyl)phenyl]carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 57383239) has the molecular formula C22H21F6N3O2 and a molecular weight of 473.42 g/mol. Its IUPAC name is N-[N'-(4-hydroxycyclohexyl)-N-[4-(trifluoromethyl)phenyl]carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N'-(4-hydroxycyclohexyl)-N-[4-(trifluoromethyl)phenyl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 57383239 |
| Molecular Formula | C22H21F6N3O2 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-[N'-(4-hydroxycyclohexyl)-N-[4-(trifluoromethyl)phenyl]carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N/C(=N\C1CCC(O)CC1)Nc1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H21F6N3O2/c23-21(24,25)14-3-1-13(2-4-14)19(33)31-20(30-17-9-11-18(32)12-10-17)29-16-7-5-15(6-8-16)22(26,27)28/h1-8,17-18,32H,9-12H2,(H2,29,30,31,33) |
| InChIKey | YZZAPCDBYJTVKH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|