C16H19F3N2O — CID 29454713
N-(dicyclopropylmethyl)-2-[4-(trifluoromethyl)anilino]acetamide (PubChem CID 29454713) has the molecular formula C16H19F3N2O and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-2-[4-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(dicyclopropylmethyl)-2-[4-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 29454713 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-(dicyclopropylmethyl)-2-[4-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C16H19F3N2O/c17-16(18,19)12-5-7-13(8-6-12)20-9-14(22)21-15(10-1-2-10)11-3-4-11/h5-8,10-11,15,20H,1-4,9H2,(H,21,22) |
| InChIKey | GDDDSYJLHJUPAK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |