C17H17F6NO2 — CID 29465196
2-[3,5-bis(trifluoromethyl)phenoxy]-N-(dicyclopropylmethyl)acetamide (PubChem CID 29465196) has the molecular formula C17H17F6NO2 and a molecular weight of 381.32 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(dicyclopropylmethyl)acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(dicyclopropylmethyl)acetamide |
|---|---|
| PubChem CID | 29465196 |
| Molecular Formula | C17H17F6NO2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N-(dicyclopropylmethyl)acetamide |
| SMILES | O=C(COc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C17H17F6NO2/c18-16(19,20)11-5-12(17(21,22)23)7-13(6-11)26-8-14(25)24-15(9-1-2-9)10-3-4-10/h5-7,9-10,15H,1-4,8H2,(H,24,25) |
| InChIKey | KONKAOHIVGPOEM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |