C12H11F6NO2 — CID 78760649
2-[3,5-bis(trifluoromethyl)phenoxy]-N,N-dimethylacetamide (PubChem CID 78760649) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 78760649 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO2/c1-19(2)10(20)6-21-9-4-7(11(13,14)15)3-8(5-9)12(16,17)18/h3-5H,6H2,1-2H3 |
| InChIKey | HEKRZUGCOZEAEJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |