C13H13F6NO — CID 103067280
2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-N-methylprop-2-en-1-amine (PubChem CID 103067280) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-N-methylprop-2-en-1-amine.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103067280 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-N-methylprop-2-en-1-amine |
| SMILES | C=C(CNC)COc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6NO/c1-8(6-20-2)7-21-11-4-9(12(14,15)16)3-10(5-11)13(17,18)19/h3-5,20H,1,6-7H2,2H3 |
| InChIKey | WTOXVDDEGZVWGI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|