C17H21F3O2 — CID 146557286
3-(4-ethyl-2-methylidenehexoxy)-5-(trifluoromethyl)benzaldehyde (PubChem CID 146557286) has the molecular formula C17H21F3O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-(4-ethyl-2-methylidenehexoxy)-5-(trifluoromethyl)benzaldehyde.
| Compound Name | 3-(4-ethyl-2-methylidenehexoxy)-5-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 146557286 |
| Molecular Formula | C17H21F3O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-(4-ethyl-2-methylidenehexoxy)-5-(trifluoromethyl)benzaldehyde |
| SMILES | C=C(COc1cc(C=O)cc(C(F)(F)F)c1)CC(CC)CC |
| InChI | InChI=1S/C17H21F3O2/c1-4-13(5-2)6-12(3)11-22-16-8-14(10-21)7-15(9-16)17(18,19)20/h7-10,13H,3-6,11H2,1-2H3 |
| InChIKey | LLHCQJLRFCDDQE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|