C11H14FNO2 — CID 107171377
2-(3-fluoro-4-methylphenoxy)-N,N-dimethylacetamide (PubChem CID 107171377) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenoxy)-N,N-dimethylacetamide.
| Compound Name | 2-(3-fluoro-4-methylphenoxy)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 107171377 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-(3-fluoro-4-methylphenoxy)-N,N-dimethylacetamide |
| SMILES | Cc1ccc(OCC(=O)N(C)C)cc1F |
| InChI | InChI=1S/C11H14FNO2/c1-8-4-5-9(6-10(8)12)15-7-11(14)13(2)3/h4-6H,7H2,1-3H3 |
| InChIKey | NHHIHEKDNKIBDL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |