C14H19FN2O2 — CID 84584622
2-[4-(but-3-enylamino)-3-fluorophenoxy]-N,N-dimethylacetamide (PubChem CID 84584622) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[4-(but-3-enylamino)-3-fluorophenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(but-3-enylamino)-3-fluorophenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 84584622 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-[4-(but-3-enylamino)-3-fluorophenoxy]-N,N-dimethylacetamide |
| SMILES | C=CCCNc1ccc(OCC(=O)N(C)C)cc1F |
| InChI | InChI=1S/C14H19FN2O2/c1-4-5-8-16-13-7-6-11(9-12(13)15)19-10-14(18)17(2)3/h4,6-7,9,16H,1,5,8,10H2,2-3H3 |
| InChIKey | GZCIWKZCOGIBJV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|