C22H17F5N4O2 — CID 118529007
N-[N'-[(3,5-difluoro-4-methylphenyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 118529007) has the molecular formula C22H17F5N4O2 and a molecular weight of 464.39 g/mol. Its IUPAC name is N-[N'-[(3,5-difluoro-4-methylphenyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N'-[(3,5-difluoro-4-methylphenyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118529007 |
| Molecular Formula | C22H17F5N4O2 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N-[N'-[(3,5-difluoro-4-methylphenyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1c(F)cc(C/N=C(\NC(=O)c2ccc(C(F)(F)F)cc2)Nc2cccc(=O)[nH]2)cc1F |
| InChI | InChI=1S/C22H17F5N4O2/c1-12-16(23)9-13(10-17(12)24)11-28-21(30-18-3-2-4-19(32)29-18)31-20(33)14-5-7-15(8-6-14)22(25,26)27/h2-10H,11H2,1H3,(H3,28,29,30,31,32,33) |
| InChIKey | DMMIJSCBPUJTSP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|