C20H15Cl2FN4O2 — CID 67974973
4-chloro-N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]benzamide (PubChem CID 67974973) has the molecular formula C20H15Cl2FN4O2 and a molecular weight of 433.27 g/mol. Its IUPAC name is 4-chloro-N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 67974973 |
| Molecular Formula | C20H15Cl2FN4O2 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 4-chloro-N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\Cc1ccc(F)cc1Cl)Nc1cccc(=O)[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2FN4O2/c21-14-7-4-12(5-8-14)19(29)27-20(26-17-2-1-3-18(28)25-17)24-11-13-6-9-15(23)10-16(13)22/h1-10H,11H2,(H3,24,25,26,27,28,29) |
| InChIKey | DMVCBGGXIHOMKW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|