C20H13ClF4N6O — CID 118375457
N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-cyanobenzamide (PubChem CID 118375457) has the molecular formula C20H13ClF4N6O and a molecular weight of 464.81 g/mol. Its IUPAC name is N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-cyanobenzamide.
| Compound Name | N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 118375457 |
| Molecular Formula | C20H13ClF4N6O |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-4-cyanobenzamide |
| SMILES | N#Cc1ccc(C(=O)N/C(=N\Cc2ccc(F)cc2Cl)Nc2cc(C(F)(F)F)[nH]n2)cc1 |
| InChI | InChI=1S/C20H13ClF4N6O/c21-15-7-14(22)6-5-13(15)10-27-19(28-17-8-16(30-31-17)20(23,24)25)29-18(32)12-3-1-11(9-26)2-4-12/h1-8H,10H2,(H3,27,28,29,30,31,32) |
| InChIKey | FBIYRKFPBIDCNP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|