C11H6ClF4N3O — CID 16659761
N-(2-chloro-4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 16659761) has the molecular formula C11H6ClF4N3O and a molecular weight of 307.63 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 16659761 |
| Molecular Formula | C11H6ClF4N3O |
| Molecular Weight | 307.63 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1Cl)c1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C11H6ClF4N3O/c12-6-3-5(13)1-2-7(6)17-10(20)8-4-9(19-18-8)11(14,15)16/h1-4H,(H,17,20)(H,18,19) |
| InChIKey | HLQHJCSMAPAWCO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |