C12H7F6N3O — CID 19508083
5-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3-carboxamide (PubChem CID 19508083) has the molecular formula C12H7F6N3O and a molecular weight of 323.20 g/mol. Its IUPAC name is 5-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19508083 |
| Molecular Formula | C12H7F6N3O |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 5-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C12H7F6N3O/c13-11(14,15)6-3-1-2-4-7(6)19-10(22)8-5-9(21-20-8)12(16,17)18/h1-5H,(H,19,22)(H,20,21) |
| InChIKey | QQCUCXSEONPZDO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |