C11H7F3N4O3 — CID 135413583
5-nitro-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3-carboxamide (PubChem CID 135413583) has the molecular formula C11H7F3N4O3 and a molecular weight of 300.20 g/mol. Its IUPAC name is 5-nitro-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-nitro-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135413583 |
| Molecular Formula | C11H7F3N4O3 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 5-nitro-N-[2-(trifluoromethyl)phenyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1cc([N+](=O)[O-])[nH]n1 |
| InChI | InChI=1S/C11H7F3N4O3/c12-11(13,14)6-3-1-2-4-7(6)15-10(19)8-5-9(17-16-8)18(20)21/h1-5H,(H,15,19)(H,16,17) |
| InChIKey | NXXVMBXYEYXYFT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|