C12H8F3N3O2 — CID 136666349
6-oxo-N-[2-(trifluoromethyl)phenyl]-1H-pyrimidine-4-carboxamide (PubChem CID 136666349) has the molecular formula C12H8F3N3O2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 6-oxo-N-[2-(trifluoromethyl)phenyl]-1H-pyrimidine-4-carboxamide.
| Compound Name | 6-oxo-N-[2-(trifluoromethyl)phenyl]-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 136666349 |
| Molecular Formula | C12H8F3N3O2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 6-oxo-N-[2-(trifluoromethyl)phenyl]-1H-pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C12H8F3N3O2/c13-12(14,15)7-3-1-2-4-8(7)18-11(20)9-5-10(19)17-6-16-9/h1-6H,(H,18,20)(H,16,17,19) |
| InChIKey | XQWXXOWCWQKUFS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |