C20H23ClF3N5O — CID 67965830
4-chloro-N-[N'-[(1S)-1-cyclohexylethyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]benzamide (PubChem CID 67965830) has the molecular formula C20H23ClF3N5O and a molecular weight of 441.89 g/mol. Its IUPAC name is 4-chloro-N-[N'-[(1S)-1-cyclohexylethyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N'-[(1S)-1-cyclohexylethyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 67965830 |
| Molecular Formula | C20H23ClF3N5O |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-chloro-N-[N'-[(1S)-1-cyclohexylethyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]benzamide |
| SMILES | C[C@H](/N=C(/NC(=O)c1ccc(Cl)cc1)Nc1cc(C(F)(F)F)[nH]n1)C1CCCCC1 |
| InChI | InChI=1S/C20H23ClF3N5O/c1-12(13-5-3-2-4-6-13)25-19(26-17-11-16(28-29-17)20(22,23)24)27-18(30)14-7-9-15(21)10-8-14/h7-13H,2-6H2,1H3,(H3,25,26,27,28,29,30)/t12-/m0/s1 |
| InChIKey | YYVGCWHSDSCNTB-LBPRGKRZSA-N |
| XLogP | 5.25 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|