C22H24F6N4O — CID 147899062
N-[C-[(2R)-2-cyclohexylpropyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbonimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 147899062) has the molecular formula C22H24F6N4O and a molecular weight of 474.45 g/mol. Its IUPAC name is N-[C-[(2R)-2-cyclohexylpropyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbonimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[C-[(2R)-2-cyclohexylpropyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbonimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 147899062 |
| Molecular Formula | C22H24F6N4O |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[C-[(2R)-2-cyclohexylpropyl]-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbonimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | C[C@H](C/C(=N\c1cc(C(F)(F)F)[nH]n1)NC(=O)c1ccc(C(F)(F)F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H24F6N4O/c1-13(14-5-3-2-4-6-14)11-18(29-19-12-17(31-32-19)22(26,27)28)30-20(33)15-7-9-16(10-8-15)21(23,24)25/h7-10,12-14H,2-6,11H2,1H3,(H2,29,30,31,32,33)/t13-/m1/s1 |
| InChIKey | IDXFXQCRCWDNRE-CYBMUJFWSA-N |
| XLogP | 6.51 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|