C20H22F5N5O — CID 77440034
N-[N'-(1-cyclohexylethyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 77440034) has the molecular formula C20H22F5N5O and a molecular weight of 443.42 g/mol. Its IUPAC name is N-[N'-(1-cyclohexylethyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N'-(1-cyclohexylethyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 77440034 |
| Molecular Formula | C20H22F5N5O |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[N'-(1-cyclohexylethyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CC(/N=C(/NC(=O)c1ccc(F)c(F)c1)Nc1cc(C(F)(F)F)[nH]n1)C1CCCCC1 |
| InChI | InChI=1S/C20H22F5N5O/c1-11(12-5-3-2-4-6-12)26-19(27-17-10-16(29-30-17)20(23,24)25)28-18(31)13-7-8-14(21)15(22)9-13/h7-12H,2-6H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | FASJRUYIKPROBK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|