C18H16ClF6N5O — CID 118375791
4-chloro-N-[N'-(4,4-difluorocyclohexyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3-fluorobenzamide (PubChem CID 118375791) has the molecular formula C18H16ClF6N5O and a molecular weight of 467.80 g/mol. Its IUPAC name is 4-chloro-N-[N'-(4,4-difluorocyclohexyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3-fluorobenzamide.
| Compound Name | 4-chloro-N-[N'-(4,4-difluorocyclohexyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 118375791 |
| Molecular Formula | C18H16ClF6N5O |
| Molecular Weight | 467.80 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 4-chloro-N-[N'-(4,4-difluorocyclohexyl)-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3-fluorobenzamide |
| SMILES | O=C(N/C(=N/C1CCC(F)(F)CC1)Nc1cc(C(F)(F)F)[nH]n1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C18H16ClF6N5O/c19-11-2-1-9(7-12(11)20)15(31)28-16(26-10-3-5-17(21,22)6-4-10)27-14-8-13(29-30-14)18(23,24)25/h1-2,7-8,10H,3-6H2,(H3,26,27,28,29,30,31) |
| InChIKey | PTLWPHNEMQFNLQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|