C22H19ClF2N4O — CID 146900828
4-chloro-N-[N-cyclobutyl-C-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]-3-fluorobenzamide (PubChem CID 146900828) has the molecular formula C22H19ClF2N4O and a molecular weight of 428.87 g/mol. Its IUPAC name is 4-chloro-N-[N-cyclobutyl-C-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]-3-fluorobenzamide.
| Compound Name | 4-chloro-N-[N-cyclobutyl-C-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 146900828 |
| Molecular Formula | C22H19ClF2N4O |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-chloro-N-[N-cyclobutyl-C-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]-3-fluorobenzamide |
| SMILES | O=C(N/C(Cc1cc(-c2ccc(F)cc2)n[nH]1)=N/C1CCC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C22H19ClF2N4O/c23-18-9-6-14(10-19(18)25)22(30)27-21(26-16-2-1-3-16)12-17-11-20(29-28-17)13-4-7-15(24)8-5-13/h4-11,16H,1-3,12H2,(H,28,29)(H,26,27,30) |
| InChIKey | PWVTUDJEIPJGIX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|