C18H18ClF3N4O2 — CID 147972242
4-chloro-N-[N-(oxan-3-yl)-C-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]benzamide (PubChem CID 147972242) has the molecular formula C18H18ClF3N4O2 and a molecular weight of 414.82 g/mol. Its IUPAC name is 4-chloro-N-[N-(oxan-3-yl)-C-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N-(oxan-3-yl)-C-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 147972242 |
| Molecular Formula | C18H18ClF3N4O2 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4-chloro-N-[N-(oxan-3-yl)-C-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]benzamide |
| SMILES | O=C(N/C(Cc1cc(C(F)(F)F)n[nH]1)=N\C1CCCOC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClF3N4O2/c19-12-5-3-11(4-6-12)17(27)24-16(23-13-2-1-7-28-10-13)9-14-8-15(26-25-14)18(20,21)22/h3-6,8,13H,1-2,7,9-10H2,(H,25,26)(H,23,24,27) |
| InChIKey | IROMLTQSHKRYMS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|