C12H13F3N2O2 — CID 124606510
N-[(3S)-oxan-3-yl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 124606510) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is N-[(3S)-oxan-3-yl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[(3S)-oxan-3-yl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124606510 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[(3S)-oxan-3-yl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCOC1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)10-4-3-8(6-16-10)11(18)17-9-2-1-5-19-7-9/h3-4,6,9H,1-2,5,7H2,(H,17,18)/t9-/m0/s1 |
| InChIKey | AAKHAYPZOPRBHZ-VIFPVBQESA-N |
| XLogP | 2.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |