C16H24Cl2F3N3O — CID 119620729
N-[2-(cycloheptylamino)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 119620729) has the molecular formula C16H24Cl2F3N3O and a molecular weight of 402.29 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119620729 |
| Molecular Formula | C16H24Cl2F3N3O |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCNC1CCCCCC1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H22F3N3O.2ClH/c17-16(18,19)14-8-7-12(11-22-14)15(23)21-10-9-20-13-5-3-1-2-4-6-13;;/h7-8,11,13,20H,1-6,9-10H2,(H,21,23);2*1H |
| InChIKey | XGJVTZRZVDTPQA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|