C12H14F3N3O2 — CID 75399276
N-(5-amino-5-oxopentyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 75399276) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is N-(5-amino-5-oxopentyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(5-amino-5-oxopentyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75399276 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(5-amino-5-oxopentyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)CCCCNC(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)9-5-4-8(7-18-9)11(20)17-6-2-1-3-10(16)19/h4-5,7H,1-3,6H2,(H2,16,19)(H,17,20) |
| InChIKey | XCEXXUSSBYXUCT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|