C17H15F5N4O — CID 147964287
N-[N-cyclobutyl-C-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]-3,4-difluorobenzamide (PubChem CID 147964287) has the molecular formula C17H15F5N4O and a molecular weight of 386.32 g/mol. Its IUPAC name is N-[N-cyclobutyl-C-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-cyclobutyl-C-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 147964287 |
| Molecular Formula | C17H15F5N4O |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[N-cyclobutyl-C-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]carbonimidoyl]-3,4-difluorobenzamide |
| SMILES | O=C(N/C(Cc1cc(C(F)(F)F)n[nH]1)=N\C1CCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H15F5N4O/c18-12-5-4-9(6-13(12)19)16(27)24-15(23-10-2-1-3-10)8-11-7-14(26-25-11)17(20,21)22/h4-7,10H,1-3,8H2,(H,25,26)(H,23,24,27) |
| InChIKey | IQBWCMOULPFMCE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|