C23H21ClF2N4O2 — CID 162300830
4-chloro-3-fluoro-N-[C-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]-N-(oxan-4-yl)carbonimidoyl]benzamide (PubChem CID 162300830) has the molecular formula C23H21ClF2N4O2 and a molecular weight of 458.90 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-[C-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]-N-(oxan-4-yl)carbonimidoyl]benzamide.
| Compound Name | 4-chloro-3-fluoro-N-[C-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]-N-(oxan-4-yl)carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 162300830 |
| Molecular Formula | C23H21ClF2N4O2 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 4-chloro-3-fluoro-N-[C-[[3-(4-fluorophenyl)-1H-pyrazol-5-yl]methyl]-N-(oxan-4-yl)carbonimidoyl]benzamide |
| SMILES | O=C(N/C(Cc1cc(-c2ccc(F)cc2)n[nH]1)=N/C1CCOCC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C23H21ClF2N4O2/c24-19-6-3-15(11-20(19)26)23(31)28-22(27-17-7-9-32-10-8-17)13-18-12-21(30-29-18)14-1-4-16(25)5-2-14/h1-6,11-12,17H,7-10,13H2,(H,29,30)(H,27,28,31) |
| InChIKey | GSENBTYPDRNJHM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|