C24H24ClFN4O3 — CID 146899666
4-chloro-3-fluoro-N-[C-[[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methyl]-N-(oxan-4-yl)carbonimidoyl]benzamide (PubChem CID 146899666) has the molecular formula C24H24ClFN4O3 and a molecular weight of 470.93 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-[C-[[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methyl]-N-(oxan-4-yl)carbonimidoyl]benzamide.
| Compound Name | 4-chloro-3-fluoro-N-[C-[[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methyl]-N-(oxan-4-yl)carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 146899666 |
| Molecular Formula | C24H24ClFN4O3 |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-chloro-3-fluoro-N-[C-[[3-(4-methoxyphenyl)-1H-pyrazol-5-yl]methyl]-N-(oxan-4-yl)carbonimidoyl]benzamide |
| SMILES | COc1ccc(-c2cc(C/C(=N/C3CCOCC3)NC(=O)c3ccc(Cl)c(F)c3)[nH]n2)cc1 |
| InChI | InChI=1S/C24H24ClFN4O3/c1-32-19-5-2-15(3-6-19)22-13-18(29-30-22)14-23(27-17-8-10-33-11-9-17)28-24(31)16-4-7-20(25)21(26)12-16/h2-7,12-13,17H,8-11,14H2,1H3,(H,29,30)(H,27,28,31) |
| InChIKey | KQEIMGFMTIOIRP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|