C16H14ClF4N5O — CID 67965742
4-chloro-N-[N'-cyclobutyl-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3-fluorobenzamide (PubChem CID 67965742) has the molecular formula C16H14ClF4N5O and a molecular weight of 403.77 g/mol. Its IUPAC name is 4-chloro-N-[N'-cyclobutyl-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3-fluorobenzamide.
| Compound Name | 4-chloro-N-[N'-cyclobutyl-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 67965742 |
| Molecular Formula | C16H14ClF4N5O |
| Molecular Weight | 403.77 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 4-chloro-N-[N'-cyclobutyl-N-[5-(trifluoromethyl)-1H-pyrazol-3-yl]carbamimidoyl]-3-fluorobenzamide |
| SMILES | O=C(N/C(=N/C1CCC1)Nc1cc(C(F)(F)F)[nH]n1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H14ClF4N5O/c17-10-5-4-8(6-11(10)18)14(27)24-15(22-9-2-1-3-9)23-13-7-12(25-26-13)16(19,20)21/h4-7,9H,1-3H2,(H3,22,23,24,25,26,27) |
| InChIKey | ZXEWIZQQAYOAJU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|