C24H21Cl2F2N5O — CID 118375704
3-chloro-N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(4-fluorophenyl)pyrazolidin-3-yl]carbamimidoyl]benzamide (PubChem CID 118375704) has the molecular formula C24H21Cl2F2N5O and a molecular weight of 504.37 g/mol. Its IUPAC name is 3-chloro-N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(4-fluorophenyl)pyrazolidin-3-yl]carbamimidoyl]benzamide.
| Compound Name | 3-chloro-N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(4-fluorophenyl)pyrazolidin-3-yl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 118375704 |
| Molecular Formula | C24H21Cl2F2N5O |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 3-chloro-N-[N'-[(2-chloro-4-fluorophenyl)methyl]-N-[5-(4-fluorophenyl)pyrazolidin-3-yl]carbamimidoyl]benzamide |
| SMILES | O=C(N/C(=N\Cc1ccc(F)cc1Cl)NC1CC(c2ccc(F)cc2)NN1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21Cl2F2N5O/c25-17-3-1-2-15(10-17)23(34)31-24(29-13-16-6-9-19(28)11-20(16)26)30-22-12-21(32-33-22)14-4-7-18(27)8-5-14/h1-11,21-22,32-33H,12-13H2,(H2,29,30,31,34) |
| InChIKey | PPLWJFHSOVWOSD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|