C20H20F3N3O2 — CID 149080870
N-[C-[(1-methylcyclobutyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbonimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 149080870) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is N-[C-[(1-methylcyclobutyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbonimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[C-[(1-methylcyclobutyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbonimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 149080870 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[C-[(1-methylcyclobutyl)methyl]-N-(6-oxo-1H-pyridin-2-yl)carbonimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC1(CC(=Nc2cccc(=O)[nH]2)NC(=O)c2ccc(C(F)(F)F)cc2)CCC1 |
| InChI | InChI=1S/C20H20F3N3O2/c1-19(10-3-11-19)12-16(24-15-4-2-5-17(27)25-15)26-18(28)13-6-8-14(9-7-13)20(21,22)23/h2,4-9H,3,10-12H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | QQHNGBPLQPRMMR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|