C23H20ClFN4O3 — CID 161382976
N-[N-acetyl-N-[(3-chloro-4-fluorophenyl)methyl]-N'-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-methylbenzamide (PubChem CID 161382976) has the molecular formula C23H20ClFN4O3 and a molecular weight of 454.89 g/mol. Its IUPAC name is N-[N-acetyl-N-[(3-chloro-4-fluorophenyl)methyl]-N'-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-methylbenzamide.
| Compound Name | N-[N-acetyl-N-[(3-chloro-4-fluorophenyl)methyl]-N'-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 161382976 |
| Molecular Formula | C23H20ClFN4O3 |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[N-acetyl-N-[(3-chloro-4-fluorophenyl)methyl]-N'-(6-oxo-1H-pyridin-2-yl)carbamimidoyl]-4-methylbenzamide |
| SMILES | CC(=O)N(Cc1ccc(F)c(Cl)c1)C(=Nc1cccc(=O)[nH]1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H20ClFN4O3/c1-14-6-9-17(10-7-14)22(32)28-23(27-20-4-3-5-21(31)26-20)29(15(2)30)13-16-8-11-19(25)18(24)12-16/h3-12H,13H2,1-2H3,(H2,26,27,28,31,32) |
| InChIKey | YNWRKKFFWUUHML-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|